AA25906
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $70.00 | $49.00 | - + | |
5g | 98% | in stock | $188.00 | $132.00 | - + | |
25g | 98% | in stock | $611.00 | $428.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA25906 |
Chemical Name: | 1H-Benzimidazole, 4-fluoro-2-methyl-1-(1-methylethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- |
CAS Number: | 1231930-37-2 |
Molecular Formula: | C17H24BFN2O2 |
Molecular Weight: | 318.1941 |
MDL Number: | MFCD25977327 |
SMILES: | Fc1cc(cc2c1nc(n2C(C)C)C)B1OC(C(O1)(C)C)(C)C |
Complexity: | 444 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 2 |
In chemical synthesis, 4-Fluoro-2-methyl-1-(1-methylethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole serves as a highly versatile building block that can be utilized in various reactions to introduce specific functional groups or structural motifs into organic molecules. This compound is particularly valuable in the formation of complex heterocyclic structures due to its unique molecular architecture, providing a strategic advantage in the synthesis of novel compounds with potential pharmaceutical or material science applications.