AA27924
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $90.00 | $63.00 | - + | |
1g | 96% | in stock | $273.00 | $191.00 | - + | |
5g | 96% | in stock | $1,109.00 | $777.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA27924 |
Chemical Name: | 4-(3-Aminophenyl)benzoic acid |
CAS Number: | 124221-69-8 |
Molecular Formula: | C13H11NO2 |
Molecular Weight: | 213.2319 |
MDL Number: | MFCD03424680 |
SMILES: | Nc1cccc(c1)c1ccc(cc1)C(=O)O |
Complexity: | 246 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.4 |
The Journal of organic chemistry 20100319