AA27923
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $65.00 | $45.00 | - + | |
1g | 97% | in stock | $163.00 | $114.00 | - + | |
5g | 97% | in stock | $573.00 | $402.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA27923 |
Chemical Name: | 3'-Aminobiphenyl-3-carboxylic acid |
CAS Number: | 124221-71-2 |
Molecular Formula: | C13H11NO2 |
Molecular Weight: | 213.2319 |
MDL Number: | MFCD03839954 |
SMILES: | Nc1cccc(c1)c1cccc(c1)C(=O)O |
Complexity: | 254 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.4 |
Journal of medicinal chemistry 20050407