AE34872
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98+% | in stock | $9.00 | $6.00 | - + | |
5mg | 98+% | in stock | $13.00 | $9.00 | - + | |
10mg | 98+% | in stock | $17.00 | $12.00 | - + | |
100mg | 98+% | in stock | $83.00 | $58.00 | - + | |
250mg | 98+% | in stock | $159.00 | $111.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE34872 |
Chemical Name: | SR-1078 |
CAS Number: | 1246525-60-9 |
Molecular Formula: | C17H10F9NO2 |
Molecular Weight: | 431.2524 |
MDL Number: | MFCD18782737 |
SMILES: | O=C(c1ccc(cc1)C(F)(F)F)Nc1ccc(cc1)C(C(F)(F)F)(C(F)(F)F)O |
Complexity: | 555 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 29 |
Hydrogen Bond Acceptor Count: | 11 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 4.8 |
The Journal of biological chemistry 20170825
Pharmacological research 20150901
PloS one 20120101
ACS chemical biology 20101119