AV97951
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $1,180.00 | $826.00 | - + | |
100mg | 95% | 1 week | $1,519.00 | $1,063.00 | - + | |
250mg | 95% | 1 week | $2,133.00 | $1,493.00 | - + | |
500mg | 95% | 1 week | $3,314.00 | $2,320.00 | - + | |
1g | 95% | 1 week | $4,223.00 | $2,956.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AV97951 |
Chemical Name: | 2-[(tert-butoxy)carbonyl]-2-azabicyclo[4.1.0]heptane-7-carboxylic acid, Mixture of diastereomers |
CAS Number: | 1251019-95-0 |
Molecular Formula: | C12H19NO4 |
Molecular Weight: | 241.2836 |
MDL Number: | MFCD14581331 |
SMILES: | OC(=O)C1C2C1N(CCC2)C(=O)OC(C)(C)C |