AE35822
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $22.00 | $16.00 | - + | |
5mg | 98% | in stock | $54.00 | $38.00 | - + | |
10mg | 98% | in stock | $79.00 | $55.00 | - + | |
25mg | 98% | in stock | $132.00 | $92.00 | - + | |
50mg | 98% | in stock | $225.00 | $157.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE35822 |
Chemical Name: | XL388 |
CAS Number: | 1251156-08-7 |
Molecular Formula: | C23H22FN3O4S |
Molecular Weight: | 455.5019 |
MDL Number: | MFCD24386875 |
SMILES: | O=C(c1ccc(c(c1C)F)S(=O)(=O)C)N1CCOc2c(C1)cc(cc2)c1ccc(=N)[nH]c1 |
Complexity: | 776 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 32 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.5 |
Journal of medicinal chemistry 20130328