AE35765
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $18.00 | $13.00 | - + | |
5mg | 98% | in stock | $43.00 | $30.00 | - + | |
10mg | 98% | in stock | $64.00 | $45.00 | - + | |
50mg | 98% | in stock | $180.00 | $126.00 | - + | |
1000mg | DMSO | in stock | $3,576.00 | $2,503.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE35765 |
Chemical Name: | Pf-4708671 |
CAS Number: | 1255517-76-0 |
Molecular Formula: | C19H21F3N6 |
Molecular Weight: | 390.4054 |
MDL Number: | MFCD18086922 |
SMILES: | CCc1cncnc1N1CCN(CC1)Cc1nc2c([nH]1)cc(cc2)C(F)(F)F |
Complexity: | 510 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 3.2 |
Toxicology letters 20150304
Bioorganic & medicinal chemistry letters 20130801
Amino acids 20120601
The Biochemical journal 20120101
The Biochemical journal 20101015