logo
Home  > 6-Bromo-1-(trifluoromethyl)isoquinoline

AY08105

1256836-88-0 | 6-Bromo-1-(trifluoromethyl)isoquinoline

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $345.00 $241.00 -   +
250mg 97% in stock $639.00 $447.00 -   +
1g 97% in stock $1,960.00 $1,372.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AY08105
Chemical Name: 6-Bromo-1-(trifluoromethyl)isoquinoline
CAS Number: 1256836-88-0
Molecular Formula: C10H5BrF3N
Molecular Weight: 276.0526
MDL Number: MFCD18257163
SMILES: Brc1ccc2c(c1)ccnc2C(F)(F)F

 

Upstream Synthesis Route 
  • 6-Bromo-1-(trifluoromethyl)isoquinoline is a versatile building block in chemical synthesis, widely utilized for its unique reactivity and functional group compatibility. Its application in organic chemistry extends to the synthesis of pharmaceuticals, agrochemicals, and materials with intricate molecular structures. This compound serves as a pivotal intermediate in the formation of complex molecules due to its ability to undergo diverse substitution reactions. Additionally, the bromine and trifluoromethyl groups in its structure endow it with distinctive physicochemical properties essential for the development of novel compounds in the field of organic synthesis.
FEATURED PRODUCTS