1257063-35-6 | N3-Peg(4)-cooh

Packsize	Purity	Availability	Price	Discounted Price
100mg	95%	in stock	$12.00	$8.00
250mg	95%	in stock	$23.00	$16.00
1g	95%	in stock	$50.00	$35.00
5g	95%	in stock	$160.00	$112.00

Description

• Catalog Number: AE40036
• Chemical Name: N3-Peg(4)-cooh
• CAS Number: 1257063-35-6
• Molecular Formula: C11H21N3O6
• Molecular Weight: 291.3009
• MDL Number: MFCD12406155
• SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCC(=O)O

Upstream Synthesis Route

The synthesis of N3-PEG(4)-COOH typically begins with the preparation of a PEG (polyethylene glycol) precursor with a terminal alkyne group, such as PEG(4)-alkyne.

1. Activation of PEG alcohol: PEG(4)-OH undergoes activation of the terminal hydroxyl group to allow for subsequent coupling steps. This is often achieved by converting the hydroxyl group into a leaving group, such as a mesylate or tosylate, via reaction with methanesulfonyl chloride (MsCl) or tosyl chloride (TsCl) in the presence of a base, such as triethylamine (TEA).

2. Introduction of alkyne group: The activated PEG derivative is then treated with an alkyne, such as propargyl alcohol, under basic conditions to produce PEG(4)-alkyne through a substitution reaction.

3. Installation of azide: In the third step, the azide group is introduced at the opposite end of the PEG chain. This is often done through nucleophilic substitution of a suitable azide source, such as sodium azide (NaN3), with a PEG derivative containing a leaving group, such as a halide or tosylate.

4. Carboxyl group attachment: Finally, the carboxyl group is attached through coupling chemistry, typically using carboxylic acids with activating reagents such as N-hydroxysuccinimide (NHS) and a coupling agent like dicyclohexylcarbodiimide (DCC) or equivalent coupling chemistry to yield the desired product, N3-PEG(4)-COOH.

Careful control of the reaction conditions and purification steps at each stage of synthesis is necessary to ensure the appropriateness of the final product for its intended application. Analytical methods such as NMR, HPLC, and mass spectrometry are employed to verify the structure and purity of the synthesized compound.