logo
Home  > Cholan-24-oic acid, 3,7-dihydroxy-, (3a,5b,7b)-

AI28921

128-13-2 | Cholan-24-oic acid, 3,7-dihydroxy-, (3a,5b,7b)-

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $12.00 $8.00 -   +
5g 98% in stock $19.00 $13.00 -   +
10g 98% in stock $30.00 $21.00 -   +
25g 98% in stock $58.00 $40.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AI28921
Chemical Name: Cholan-24-oic acid, 3,7-dihydroxy-, (3a,5b,7b)-
CAS Number: 128-13-2
Molecular Formula: C24H40O4
Molecular Weight: 392.572
MDL Number: MFCD00003680
SMILES: O[C@H]1CC[C@]2(C(C1)C[C@@H]([C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2[C@@H](CCC(=O)O)C)C)O)C

 

Computed Properties
Complexity: 605  
Covalently-Bonded Unit Count: 1  
Defined Atom Stereocenter Count: 10  
Heavy Atom Count: 28  
Hydrogen Bond Acceptor Count: 4  
Hydrogen Bond Donor Count: 3  
Rotatable Bond Count: 4  
XLogP3: 4.9  

 

 

Upstream Synthesis Route 
  • Ursodeoxycholic acid, also known as UDCA, is a naturally occurring bile acid that plays a crucial role in various chemical synthesis applications. In organic chemistry, UDCA is often used as a chiral building block due to its unique stereochemistry, which can influence the outcome of reactions in a highly specific manner. Its structural characteristics make it a valuable starting material for the synthesis of complex molecules and pharmaceutical intermediates. Additionally, UDCA's ability to undergo selective functional group transformations makes it a versatile tool in the development of new synthetic pathways. Beyond its role in organic synthesis, Ursodeoxycholic acid is also utilized in the production of specialized reagents and catalysts, further highlighting its importance in the field of chemical research and development.
Literature
FEATURED PRODUCTS