AA43738
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $18.00 | $13.00 | - + | |
5mg | 99% | in stock | $38.00 | $27.00 | - + | |
10mg | 99% | in stock | $54.00 | $38.00 | - + | |
50mg | 99% | in stock | $152.00 | $106.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA43738 |
Chemical Name: | Gdc-0032 |
CAS Number: | 1282512-48-4 |
Molecular Formula: | C24H28N8O2 |
Molecular Weight: | 460.5315 |
MDL Number: | MFCD26142641 |
SMILES: | Cc1nn(c(n1)c1cn2c(-c3ccc(cc3OCC2)c2cnn(c2)C(C(=O)N)(C)C)n1)C(C)C |
Complexity: | 751 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 34 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 1.8 |
Gynecologic oncology 20141101
Journal of medicinal chemistry 20130613