AA44867
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $6.00 | $5.00 | - + | |
1g | 97% | in stock | $18.00 | $13.00 | - + | |
5g | 97% | in stock | $66.00 | $46.00 | - + | |
25g | 97% | in stock | $283.00 | $198.00 | - + | |
100g | 97% | in stock | $914.00 | $640.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA44867 |
Chemical Name: | 3-Bromo-4-fluoro-5-nitrobenzoic acid |
CAS Number: | 1290117-21-3 |
Molecular Formula: | C7H3BrFNO4 |
Molecular Weight: | 264.0054 |
MDL Number: | MFCD18914494 |
SMILES: | [O-][N+](=O)c1cc(cc(c1F)Br)C(=O)O |
Complexity: | 257 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.1 |
3-Bromo-4-fluoro-5-nitrobenzoic acid is a versatile chemical compound widely used in chemical synthesis processes. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and functional materials. Its unique molecular structure makes it an important intermediate in the development of advanced chemical products due to its compatibility with a wide range of reactions.One significant application of 3-Bromo-4-fluoro-5-nitrobenzoic acid is in the synthesis of specialized pharmaceuticals. This compound plays a crucial role in the production of targeted drug molecules with specific biological activities, making it a valuable tool for medicinal chemistry research and drug development. Additionally, its incorporation in the synthesis of agrochemicals contributes to the creation of potent pesticides and herbicides that help enhance agricultural productivity.In the field of material science, 3-Bromo-4-fluoro-5-nitrobenzoic acid finds utility in the synthesis of functional materials with unique properties. By utilizing this compound as a precursor, researchers can fabricate materials with tailored characteristics such as enhanced conductivity, optical properties, or mechanical strength. This versatility makes 3-Bromo-4-fluoro-5-nitrobenzoic acid a crucial component in the design and development of advanced materials for various industrial applications.