AA45256
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 98% | 2 weeks | $154.00 | $108.00 | - + | |
250mg | 98% | 2 weeks | $435.00 | $304.00 | - + | |
1g | 98% | 2 weeks | $1,275.00 | $892.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA45256 |
Chemical Name: | 2,1,3-Benzothiadiazole, 4,7-bis[5-bromo-4-(2-ethylhexyl)-2-thienyl]-5,6-difluoro-, polymer with 1,1'-[4,8-bis(3-butylnonyl)benzo[1,2-b:4,5-b']dithiophene-2,6-diyl]bis[1,1,1-trimethylstannane] |
CAS Number: | 1293389-32-8 |
Molecular Formula: | C30H44Br2F2N2S3 |
Molecular Weight: | 726.6836 |
MDL Number: | MFCD29918163 |
SMILES: | CCCCC(Cc1cc(sc1Br)c1c(F)c(F)c(c2c1ns[nH]2)c1cc(c(s1)Br)CC(CCCC)CC)CC |