AA38443
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $6.00 | $4.00 | - + | |
5g | 98% | in stock | $7.00 | $5.00 | - + | |
10g | 98% | in stock | $11.00 | $8.00 | - + | |
25g | 98% | in stock | $22.00 | $16.00 | - + | |
100g | 98% | in stock | $86.00 | $60.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA38443 |
Chemical Name: | (S)-(-)-Trityl glycidyl ether |
CAS Number: | 129940-50-7 |
Molecular Formula: | C22H20O2 |
Molecular Weight: | 316.3930 |
MDL Number: | MFCD00273373 |
SMILES: | O1C[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
Complexity: | 330 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | 4.4 |
Journal of medicinal chemistry 20070308