AB71092
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 97% | in stock | $6.00 | $4.00 | - + | |
25g | 97% | in stock | $9.00 | $6.00 | - + | |
100g | 95% | in stock | $10.00 | $7.00 | - + | |
500g | 97% | in stock | $21.00 | $15.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB71092 |
Chemical Name: | Beta-D-Ribofuranose 1,2,3,5-tetraacetate |
CAS Number: | 13035-61-5 |
Molecular Formula: | C13H18O9 |
Molecular Weight: | 318.2766 |
MDL Number: | MFCD00005358 |
SMILES: | CC(=O)OC[C@H]1O[C@H]([C@@H]([C@@H]1OC(=O)C)OC(=O)C)OC(=O)C |
Complexity: | 458 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 9 |
Rotatable Bond Count: | 9 |
XLogP3: | 0.7 |
Nucleosides, nucleotides & nucleic acids 20100101
Nature chemical biology 20081201
Journal of medicinal chemistry 20071227
The Journal of chemical physics 20070221
Carbohydrate research 20040428
Carbohydrate research 20031031
Nucleic acids research. Supplement (2001) 20030101