AI29754
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 96% | in stock | $113.00 | $79.00 | - + | |
5g | 96% | in stock | $318.00 | $223.00 | - + | |
25g | 96% | in stock | $1,317.00 | $922.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI29754 |
Chemical Name: | 3-Amino-5-(ethoxycarbonyl)benzoic acid |
CAS Number: | 1312425-07-2 |
Molecular Formula: | C10H11NO4 |
Molecular Weight: | 209.1986 |
MDL Number: | MFCD23703013 |
SMILES: | CCOC(=O)c1cc(N)cc(c1)C(=O)O |
Complexity: | 254 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 1 |
Applied microbiology and biotechnology 20031001