AI29830
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $13.00 | $9.00 | - + | |
25g | 98% | in stock | $25.00 | $17.00 | - + | |
100g | 98% | in stock | $58.00 | $40.00 | - + | |
500g | 98% | in stock | $172.00 | $120.00 | - + | |
1kg | 98% | in stock | $286.00 | $200.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI29830 |
Chemical Name: | Boc-Leu-OH |
CAS Number: | 13139-15-6 |
Molecular Formula: | C11H21NO4 |
Molecular Weight: | 231.2887 |
MDL Number: | MFCD00065582 |
SMILES: | CC(C[C@@H](C(=O)O)NC(=O)OC(C)(C)C)C |
Complexity: | 255 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | 2.2 |
The Journal of organic chemistry 20091002
Nature chemical biology 20090101