BO99319
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | >95% | 2 weeks | $1,415.00 | $990.00 | - + | |
10mg | >95% | 2 weeks | $2,100.00 | $1,470.00 | - + | |
25mg | >95% | 2 weeks | $3,472.00 | $2,430.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BO99319 |
Chemical Name: | Pregn-4-ene-3,20-dione-2,2,6,6,17,21,21,21-d8 (mixture of isotopomers) |
CAS Number: | 1314917-13-9 |
Molecular Formula: | C21H22D8O2 |
Molecular Weight: | 322.5110 |
SMILES: | O=C1C=C2C([2H])([2H])C[C@@H]3[C@@H]([C@]2(CC1([2H])[2H])C)CC[C@]1([C@H]3CC[C@]1([2H])C(=O)C([2H])([2H])[2H])C |