AA46466
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $12.00 | $9.00 | - + | |
5g | 98% | in stock | $32.00 | $23.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA46466 |
Chemical Name: | Boc-L-3-cyanophenylalanine |
CAS Number: | 131980-30-8 |
Molecular Formula: | C15H18N2O4 |
Molecular Weight: | 290.3144 |
MDL Number: | MFCD00797560 |
SMILES: | N#Cc1cccc(c1)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Complexity: | 433 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | 2.2 |
Boc-Phe(3-CN)-OH is a versatile chemical compound widely utilized in chemical synthesis as a key building block for the production of various pharmaceuticals and fine chemicals. Known for its high purity and exceptional reactivity, Boc-Phe(3-CN)-OH serves as a valuable intermediate in the synthesis of peptides, especially in the pharmaceutical industry.This compound is commonly employed in the solid-phase peptide synthesis (SPPS) process, where it acts as a protected amino acid. The Boc (tert-butoxycarbonyl) protecting group plays a crucial role in safeguarding the amino group of the phenylalanine residue, allowing for selective deprotection and subsequent coupling reactions with other amino acids. This controlled deprotection strategy ensures the formation of precise peptide sequences with minimal side reactions, leading to high yields and purity of the final product.Moreover, the incorporation of the 3-CN (3-cyano) functional group in Boc-Phe(3-CN)-OH offers additional synthetic opportunities for introducing diverse chemical moieties into the peptide structure. This feature enhances the structural diversity and biological activity of the synthesized peptides, making them valuable candidates for drug discovery and development.Overall, Boc-Phe(3-CN)-OH stands as a vital component in the toolkit of organic chemists and pharmaceutical researchers, enabling the efficient and tailored synthesis of complex peptides with specific functionalities for various applications in biotechnology, medicinal chemistry, and academic research.