AA46463
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 99% | in stock | $121.00 | $85.00 | - + | |
5g | 99% | in stock | $370.00 | $259.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA46463 |
Chemical Name: | (E)-1-Bromo-4-(2-nitroprop-1-en-1-yl)benzene |
CAS Number: | 131981-75-4 |
Molecular Formula: | C9H8BrNO2 |
Molecular Weight: | 242.0693 |
MDL Number: | MFCD01317591 |
SMILES: | C/C(=C\c1ccc(cc1)Br)/[N+](=O)[O-] |
Complexity: | 214 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.2 |
European journal of medicinal chemistry 20101201