AA46497
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $38.00 | $26.00 | - + | |
1g | 95% | in stock | $77.00 | $54.00 | - + | |
5g | 95% | in stock | $253.00 | $177.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA46497 |
Chemical Name: | 2,3-O-Isopropylidene-D-ribofuranoside |
CAS Number: | 13199-25-2 |
Molecular Formula: | C8H14O5 |
Molecular Weight: | 190.1938 |
MDL Number: | MFCD01075718 |
SMILES: | OC[C@H]([C@H]1OC(O[C@H]1C=O)(C)C)O |
2,3-O-Isopropylidene-D-ribose, also known as IPDR, is a valuable compound widely utilized in various chemical synthesis processes. This compound plays a crucial role as a protecting group for the hydroxyl group of ribose. By selectively masking the hydroxyl group at position 2 and 3 with the isopropylidene moiety, IPDR effectively prevents unwanted reactions at these sites during complex chemical transformations. In organic synthesis, IPDR is commonly employed as a temporary protective group for ribose in the synthesis of nucleosides, nucleotides, and other biologically significant molecules. With the hydroxyl groups shielded, chemists can manipulate the remaining functional groups on the ribose scaffold without interference, facilitating the formation of desired products with high purity and efficiency.Moreover, the deprotection of IPDR can be easily achieved under mild conditions, such as acidic hydrolysis, allowing for the selective removal of the protective group without affecting the integrity of the rest of the molecule. This versatility makes 2,3-O-Isopropylidene-D-ribose a valuable building block in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals that contain ribose moieties.