AA48392
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $25.00 | $17.00 | - + | |
5g | 95% | in stock | $41.00 | $29.00 | - + | |
25g | 95% | in stock | $113.00 | $79.00 | - + | |
100g | 95% | in stock | $265.00 | $186.00 | - + | |
500g | 95% | in stock | $1,007.00 | $705.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA48392 |
Chemical Name: | Oleic acid compound with propane-1,2-diol (1:1) |
CAS Number: | 1330-80-9 |
Molecular Formula: | C21H42O4 |
Molecular Weight: | 358.5558 |
MDL Number: | MFCD00046647 |
SMILES: | OCC(O)C.CCCCCCCCC=CCCCCCCCC(=O)O |