AA52426
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $9.00 | $6.00 | - + | |
5g | 98% | in stock | $10.00 | $7.00 | - + | |
10g | 98% | in stock | $19.00 | $13.00 | - + | |
25g | 98% | in stock | $33.00 | $23.00 | - + | |
100g | 95% | in stock | $103.00 | $73.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA52426 |
Chemical Name: | 3-Nitrophenylboronic acid |
CAS Number: | 13331-27-6 |
Molecular Formula: | C6H6BNO4 |
Molecular Weight: | 166.9271 |
MDL Number: | MFCD00007193 |
SMILES: | OB(c1cccc(c1)[N+](=O)[O-])O |
Complexity: | 169 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
Journal of agricultural and food chemistry 20111109
Analytical and bioanalytical chemistry 20101001
Antiviral chemistry & chemotherapy 20100811
Bioorganic & medicinal chemistry letters 20100601
Chemical communications (Cambridge, England) 20100407
Journal of medicinal chemistry 20091008
Neuroscience letters 20081017
Inorganic chemistry 20080303
Chemical communications (Cambridge, England) 20080121
Angewandte Chemie (International ed. in English) 20080101
Organic & biomolecular chemistry 20040521
Bioorganic & medicinal chemistry letters 20040105
The Prostate 20030101
Journal of medicinal chemistry 20020718
Journal of combinatorial chemistry 20020101