AB51888
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98+% | in stock | $41.00 | $29.00 | - + | |
10mg | 98+% | in stock | $150.00 | $105.00 | - + | |
50mg | 98+% | in stock | $405.00 | $284.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB51888 |
Chemical Name: | Itacitinib |
CAS Number: | 1334298-90-6 |
Molecular Formula: | C26H23F4N9O |
Molecular Weight: | 553.5141 |
MDL Number: | MFCD28579595 |
SMILES: | N#CCC1(CN(C1)C1CCN(CC1)C(=O)c1ccnc(c1F)C(F)(F)F)n1ncc(c1)c1ncnc2c1cc[nH]2 |
Complexity: | 977 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 40 |
Hydrogen Bond Acceptor Count: | 11 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 1.6 |
The Journal of biological chemistry 19760125