logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Other Aromatic Heterocycles  > 2-(4-(((2-Amino-4-oxo-3,4-dihydropteridin-6-yl)methyl)amino)benzamido)-4-formylpentanedioic acid

AE39213

134-05-4 | 2-(4-(((2-Amino-4-oxo-3,4-dihydropteridin-6-yl)methyl)amino)benzamido)-4-formylpentanedioic acid

Packsize Purity Availability Price Discounted Price    Quantity
100mg 98% in stock $176.00 $123.00 -   +
250mg 98% in stock $333.00 $233.00 -   +
1g 98% in stock $898.00 $628.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE39213
Chemical Name: 2-(4-(((2-Amino-4-oxo-3,4-dihydropteridin-6-yl)methyl)amino)benzamido)-4-formylpentanedioic acid
CAS Number: 134-05-4
Molecular Formula: C20H19N7O7
Molecular Weight: 469.4076
MDL Number: MFCD22666228
SMILES: O=CN(c1ccc(cc1)C(=O)N[C@H](C(=O)O)CCC(=O)O)Cc1c[nH]c2-c(n1)c(=O)nc(n2)N

 

Computed Properties
Complexity: 843  
Covalently-Bonded Unit Count: 1  
Defined Atom Stereocenter Count: 1  
Heavy Atom Count: 34  
Hydrogen Bond Acceptor Count: 10  
Hydrogen Bond Donor Count: 5  
Rotatable Bond Count: 9  
XLogP3: -1.7  

 

 

Upstream Synthesis Route 
  • The compound N-[4-[[(2-Amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]formylamino]benzoyl]-L-glutamic acid, also known as $name$, plays a crucial role in chemical synthesis as a versatile intermediate. Its unique structure allows for functional group manipulations, making it an indispensable building block in the creation of complex organic molecules. $name$ is commonly utilized in the pharmaceutical industry for the synthesis of various drugs and bioactive compounds. Its formylamino and benzoyl groups provide key starting points for diverse chemical transformations, enabling the synthesis of structurally diverse molecules. This compound's involvement in chemical synthesis highlights its significance in modern organic chemistry research and applications.
FEATURED PRODUCTS