AX16115
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 99% | in stock | $65.00 | $46.00 | - + | |
10mg | 99% | in stock | $119.00 | $83.00 | - + | |
25mg | 99% | in stock | $153.00 | $107.00 | - + | |
50mg | 99% | in stock | $202.00 | $141.00 | - + | |
250mg | 99% | in stock | $429.00 | $300.00 | - + | |
1g | 99% | in stock | $1,068.00 | $748.00 | - + | |
5g | 99% | in stock | $3,206.00 | $2,245.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX16115 |
Chemical Name: | 1H-Pyrrole-1-heptanoic acid,2-(4-fluorophenyl)-b,d-dihydroxy-5-(1-methylethyl)-3-phenyl-4-[(phenylamino)carbonyl]-, monosodium salt, (bR,dR)- |
CAS Number: | 134523-01-6 |
Molecular Formula: | C33H34FN2NaO5 |
Molecular Weight: | 580.6216 |
MDL Number: | MFCD08458204 |
SMILES: | O[C@@H](C[C@H](CC(=O)[O-])O)CCn1c(C(C)C)c(c(c1c1ccc(cc1)F)c1ccccc1)C(=O)Nc1ccccc1.[Na+] |
Complexity: | 829 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 42 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 12 |
Journal of medicinal chemistry 19910101