AE35377
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $8.00 | $5.00 | - + | |
1g | 95% | in stock | $19.00 | $13.00 | - + | |
5g | 95% | in stock | $68.00 | $48.00 | - + | |
10g | 95% | in stock | $114.00 | $80.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE35377 |
Chemical Name: | Boc-Asn-OBzl |
CAS Number: | 13512-57-7 |
Molecular Formula: | C16H22N2O5 |
Molecular Weight: | 322.3563 |
MDL Number: | MFCD00190784 |
SMILES: | NC(=O)C[C@@H](C(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
Complexity: | 425 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 9 |
XLogP3: | 1.2 |
The (S)-Benzyl 4-amino-2-((tert-butoxycarbonyl)amino)-4-oxobutanoate is a key compound used in chemical synthesis for the preparation of peptide molecules. Its application lies in its ability to function as a protected amino acid derivative, enabling the selective introduction of specific amino acid residues into peptide chains. This compound serves as a crucial building block in solid-phase peptide synthesis, allowing for the controlled assembly of peptides with high purity and efficiency. By incorporating (S)-Benzyl 4-amino-2-((tert-butoxycarbonyl)amino)-4-oxobutanoate into peptide synthesis reactions, chemists can efficiently create complex peptide structures with tailored functionalities and properties.