AB53168
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
2mg | 98% | in stock | $14.00 | $10.00 | - + | |
5mg | 98% | in stock | $23.00 | $17.00 | - + | |
25mg | 98%(HPLC) | in stock | $106.00 | $75.00 | - + | |
100mg | 98%(HPLC) | in stock | $317.00 | $222.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB53168 |
Chemical Name: | EW 7197 |
CAS Number: | 1352608-82-2 |
Molecular Formula: | C22H18FN7 |
Molecular Weight: | 399.4236 |
MDL Number: | MFCD28348363 |
SMILES: | Cc1cccc(n1)c1[nH]c(nc1c1ccc2n(c1)ncn2)CNc1ccccc1F |
Complexity: | 566 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 30 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 3.2 |
Journal of medicinal chemistry 20140522