AD72568
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $558.00 | $391.00 | - + | |
1g | 98% | in stock | $1,536.00 | $1,075.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD72568 |
Chemical Name: | 3-Hydroxy-2-[3-hydroxy-4-(pyrrolidin-1-yl)phenyl]-6,7-dimethylchromen-4-one |
CAS Number: | 1353224-67-5 |
Molecular Formula: | C21H21NO4 |
Molecular Weight: | 351.3957 |
MDL Number: | MFCD22192467 |
SMILES: | Oc1cc(ccc1N1CCCC1)c1oc2cc(C)c(cc2c(=O)c1O)C |
Complexity: | 583 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 4 |
Journal of medicinal chemistry 20120112