AE61644
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $18.00 | $13.00 | - + | |
250mg | 98% | in stock | $31.00 | $22.00 | - + | |
1g | 98% | in stock | $42.00 | $30.00 | - + | |
2.5g | 98% | in stock | $85.00 | $60.00 | - + | |
5g | 98% | in stock | $156.00 | $110.00 | - + | |
10g | 98% | in stock | $312.00 | $219.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE61644 |
Chemical Name: | Chloro[(tricyclohexylphosphine)-2-(2'-aminobiphenyl)]palladium(II) |
CAS Number: | 1353658-81-7 |
Molecular Formula: | C30H43ClNPPd |
Molecular Weight: | 590.5158810000001 |
MDL Number: | MFCD21363051 |
SMILES: | [Cl-][Pd+2]1(Nc2ccccc2C2=CC=CC=[C-]12)P(C1CCCCC1)(C1CCCCC1)C1CCCCC1 |
Chloro[(tricyclohexylphosphine)-2-(2'-aminobiphenyl)]palladium(II) is a versatile catalyst widely used in chemical synthesis, particularly in organic reactions. Its unique structure and composition make it a highly effective tool for promoting various transformations in the lab.One key application of this compound is in cross-coupling reactions, where it serves as a catalyst to facilitate the formation of new carbon-carbon bonds. This process is essential in the construction of complex organic molecules, which are often required in the pharmaceutical, agrochemical, and materials industries.Additionally, Chloro[(tricyclohexylphosphine)-2-(2'-aminobiphenyl)]palladium(II) can also be employed in the functionalization of aromatics, such as coupling reactions with aryl halides or pseudohalides. This allows for the introduction of diverse functional groups onto aromatic substrates, expanding the synthetic possibilities and enabling the creation of novel compounds.Furthermore, the catalytic properties of this compound make it particularly valuable in the realm of sustainable chemistry. By promoting efficient and selective reactions, Chloro[(tricyclohexylphosphine)-2-(2'-aminobiphenyl)]palladium(II) contributes to the development of greener synthetic routes with decreased waste generation and improved atom economy.