AA48971
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $8.00 | $5.00 | - + | |
1g | 95% | in stock | $9.00 | $6.00 | - + | |
5g | 95% | in stock | $33.00 | $23.00 | - + | |
25g | 95% | in stock | $59.00 | $42.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA48971 |
Chemical Name: | H-Orn(Boc)-OH |
CAS Number: | 13650-49-2 |
Molecular Formula: | C10H20N2O4 |
Molecular Weight: | 232.2768 |
MDL Number: | MFCD00150499 |
SMILES: | N[C@H](C(=O)O)CCCNC(=O)OC(C)(C)C |
Complexity: | 248 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 7 |
XLogP3: | -2.3 |
Nature chemical biology 20090101
The Journal of organic chemistry 20050916