AA49188
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $73.00 | $51.00 | - + | |
5g | 95% | in stock | $201.00 | $141.00 | - + | |
10g | 95% | in stock | $297.00 | $208.00 | - + | |
25g | 95% | in stock | $572.00 | $400.00 | - + | |
100g | 95% | in stock | $1,535.00 | $1,074.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA49188 |
Chemical Name: | Aminotriester |
CAS Number: | 136586-99-7 |
Molecular Formula: | C22H41NO6 |
Molecular Weight: | 415.564 |
MDL Number: | MFCD07357283 |
SMILES: | O=C(OC(C)(C)C)CCC(CCC(=O)OC(C)(C)C)(CCC(=O)OC(C)(C)C)N |
Complexity: | 485 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 29 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 15 |
XLogP3: | 2.7 |
The Journal of organic chemistry 20050610