AA50396
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $8.00 | $5.00 | - + | |
10g | 98% | in stock | $10.00 | $7.00 | - + | |
25g | 98% | in stock | $22.00 | $15.00 | - + | |
100g | 98% | in stock | $56.00 | $39.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA50396 |
Chemical Name: | Boc-Arg-OH |
CAS Number: | 13726-76-6 |
Molecular Formula: | C11H22N4O4 |
Molecular Weight: | 274.31678 |
MDL Number: | MFCD00042632 |
SMILES: | OC(=O)[C@@H](NC(=O)OC(C)(C)C)CCCNC(=N)N |
Complexity: | 345 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 8 |
XLogP3: | -0.3 |
Journal of agricultural and food chemistry 20110112
The Biochemical journal 20020515