AB45676
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $8.00 | $5.00 | - + | |
5g | 98% | in stock | $10.00 | $7.00 | - + | |
10g | 98% | in stock | $16.00 | $11.00 | - + | |
25g | 98% | in stock | $20.00 | $14.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB45676 |
Chemical Name: | Boc-Ser(tBu)-OH |
CAS Number: | 13734-38-8 |
Molecular Formula: | C12H23NO5 |
Molecular Weight: | 261.3147 |
MDL Number: | MFCD00079666 |
SMILES: | O=C(OC(C)(C)C)N[C@H](C(=O)O)COC(C)(C)C |
Complexity: | 301 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
XLogP3: | 1.4 |
Boc-Ser(tBu)-OH, also known as N-tert-butoxycarbonyl-L-serine, is a commonly used building block in organic synthesis. This compound is versatile and plays a crucial role in peptide synthesis, pharmaceutical development, and other chemical reactions.In chemical synthesis, Boc-Ser(tBu)-OH is often used as a protected amino acid due to its unique properties. The Boc (tert-butoxycarbonyl) group serves as a protective group for the serine amino acid, allowing for selective reactions while keeping other functional groups intact. This protection strategy is particularly important in peptide synthesis, where multiple amino acids are linked together to form longer peptide chains.Boc-Ser(tBu)-OH can be selectively deprotected under mild acidic conditions, revealing the free serine amino acid for further chemical modifications or peptide coupling reactions. This controlled deprotection step is essential for the successful synthesis of complex peptides and pharmaceutical compounds.Overall, Boc-Ser(tBu)-OH is a valuable tool in chemical synthesis for the production of peptides, pharmaceuticals, and other organic molecules. Its unique properties as a protected amino acid make it a key component in building complex molecular structures with precision and efficiency.