AA56589
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA56589 |
Chemical Name: | Cpi-0610 |
CAS Number: | 1380087-89-7 |
Molecular Formula: | C20H16ClN3O2 |
Molecular Weight: | 365.8129 |
MDL Number: | MFCD28144505 |
SMILES: | NC(=O)C[C@@H]1N=C(c2ccc(cc2)Cl)c2c(c3c1onc3C)cccc2 |
Complexity: | 561 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 3 |
Journal of medicinal chemistry 20160225