BH86982
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $530.00 | $371.00 | - + | |
100mg | 95% | 1 week | $766.00 | $537.00 | - + | |
250mg | 95% | 1 week | $1,072.00 | $750.00 | - + | |
500mg | 95% | 1 week | $1,658.00 | $1,161.00 | - + | |
1g | 95% | 1 week | $2,112.00 | $1,479.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BH86982 |
Chemical Name: | (2S)-3-(dimethylcarbamoyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanoicacid |
CAS Number: | 138585-02-1 |
Molecular Formula: | C21H22N2O5 |
Molecular Weight: | 382.4098 |
MDL Number: | MFCD31719233 |
SMILES: | O=C(N[C@H](C(=O)O)CC(=O)N(C)C)OCC1c2ccccc2c2c1cccc2 |
Fmoc-N,N-dimethyl-L-asparagine, a versatile building block in chemical synthesis, serves as a crucial reagent for the modification and functionalization of peptides. With its masked amine group and dimethyl substitution, this compound offers unique properties suitable for solid-phase peptide synthesis (SPPS) and other organic reactions. Its compatibility with Fmoc-based protection strategies makes it ideal for the synthesis of complex peptide sequences with improved purity and yield. Additionally, Fmoc-N,N-dimethyl-L-asparagine enables the selective introduction of aromatic and alkyl groups into peptide structures, expanding the chemical diversity and enhancing the bioactivity of the resulting compounds. Its strategic application in peptide chemistry underscores its significance as a valuable tool for researchers and chemists seeking to unlock the full potential of peptide-based therapeutics and materials.