AA62410
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $29.00 | $20.00 | - + | |
5mg | 98% | in stock | $63.00 | $44.00 | - + | |
10mg | 98% | in stock | $82.00 | $57.00 | - + | |
50mg | 98% | in stock | $240.00 | $168.00 | - + | |
100mg | 98% | in stock | $379.00 | $265.00 | - + | |
250mg | 98% | in stock | $652.00 | $456.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA62410 |
Chemical Name: | Nexturastat a |
CAS Number: | 1403783-31-2 |
Molecular Formula: | C19H23N3O3 |
Molecular Weight: | 341.4042 |
MDL Number: | MFCD28099804 |
SMILES: | CCCCN(C(=O)Nc1ccccc1)Cc1ccc(cc1)C(=O)NO |
Complexity: | 416 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 7 |
XLogP3: | 2.6 |
Journal of medicinal chemistry 20121126