AA67451
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $6.00 | $4.00 | - + | |
5g | 98% | in stock | $16.00 | $11.00 | - + | |
25g | 98% | in stock | $66.00 | $46.00 | - + | |
100g | 98% | in stock | $183.00 | $129.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA67451 |
Chemical Name: | 2,3:5,6-Di-o-isopropylidene-alpha-d-mannofuranose |
CAS Number: | 14131-84-1 |
Molecular Formula: | C12H20O6 |
Molecular Weight: | 260.2836 |
MDL Number: | MFCD00134206 |
SMILES: | OC1O[C@@H]([C@H]2[C@@H]1OC(O2)(C)C)[C@H]1COC(O1)(C)C |
Complexity: | 342 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 5 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
Medicinal chemistry (Shariqah (United Arab Emirates)) 20091101
Bioconjugate chemistry 20080701
Bioconjugate chemistry 20070101
The Journal of organic chemistry 20051125
Carbohydrate research 20030926