AA67848
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $33.00 | $23.00 | - + | |
5g | 95% | in stock | $87.00 | $61.00 | - + | |
10g | 95% | in stock | $92.00 | $65.00 | - + | |
100g | 95% | in stock | $723.00 | $506.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA67848 |
Chemical Name: | 1-Methyl-3,5-dinitro-1H-pyridin-2-one |
CAS Number: | 14150-94-8 |
Molecular Formula: | C6H5N3O5 |
Molecular Weight: | 199.121 |
MDL Number: | MFCD00456280 |
SMILES: | [O-][N+](=O)c1cn(C)c(=O)c(c1)[N+](=O)[O-] |
Complexity: | 372 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
The Journal of organic chemistry 20090306