AA67848
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $5.00 | $4.00 | - + | |
250mg | 95% | in stock | $9.00 | $7.00 | - + | |
1g | 98% | in stock | $19.00 | $13.00 | - + | |
5g | 95% | in stock | $49.00 | $35.00 | - + | |
10g | 95% | in stock | $80.00 | $56.00 | - + | |
25g | 95% | in stock | $159.00 | $112.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA67848 |
Chemical Name: | 1-Methyl-3,5-dinitro-1H-pyridin-2-one |
CAS Number: | 14150-94-8 |
Molecular Formula: | C6H5N3O5 |
Molecular Weight: | 199.1210 |
MDL Number: | MFCD00456280 |
SMILES: | [O-][N+](=O)c1cn(C)c(=O)c(c1)[N+](=O)[O-] |
Complexity: | 372 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
The Journal of organic chemistry 20090306