AA68417
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $22.00 | $15.00 | - + | |
1g | 98% | in stock | $24.00 | $17.00 | - + | |
2g | 95% | in stock | $27.00 | $19.00 | - + | |
5g | 95% | in stock | $46.00 | $32.00 | - + | |
10g | 95% | in stock | $81.00 | $57.00 | - + | |
15g | 95% | in stock | $112.00 | $79.00 | - + | |
25g | 95% | in stock | $160.00 | $112.00 | - + | |
50g | 95% | in stock | $248.00 | $174.00 | - + | |
100g | 95% | in stock | $389.00 | $272.00 | - + | |
250g | 95% | in stock | $775.00 | $543.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA68417 |
Chemical Name: | 4-Chloro-DL-phenylalanine methyl ester, HCl |
CAS Number: | 14173-40-1 |
Molecular Formula: | C10H13Cl2NO2 |
Molecular Weight: | 250.1217 |
MDL Number: | MFCD00012530 |
SMILES: | COC(=O)[C@H](Cc1ccc(cc1)Cl)N.Cl |
Complexity: | 191 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
Undefined Atom Stereocenter Count: | 1 |
Cytometry. Part A : the journal of the International Society for Analytical Cytology 20060501