AA68531
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $114.00 | $80.00 | - + | |
5g | 95% | in stock | $169.00 | $118.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA68531 |
Chemical Name: | 2-Ethylsulfonylimidazo[1,2-a]pyridine-3-sulfonamide |
CAS Number: | 141776-47-8 |
Molecular Formula: | C9H11N3O4S2 |
Molecular Weight: | 289.33133999999995 |
MDL Number: | MFCD09743548 |
SMILES: | CCS(=O)(=O)c1nc2n(c1S(=O)(=O)N)cccc2 |
Complexity: | 505 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.6 |
Journal of agricultural and food chemistry 20020731