logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Tetrahydropyrans  > N-Acetyl-D-galactosamine

AB50268

14215-68-0 | N-Acetyl-D-galactosamine

Packsize Purity Availability Price Discounted Price    Quantity
500mg 98% in stock $10.00 $7.00 -   +
1g 98% in stock $18.00 $12.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB50268
Chemical Name: N-Acetyl-D-galactosamine
CAS Number: 14215-68-0
Molecular Formula: C8H15NO6
Molecular Weight: 221.2078
MDL Number: MFCD00065372
SMILES: OC[C@H]1O[C@H](O)[C@@H]([C@H]([C@H]1O)O)NC(=O)C

 

Computed Properties
Complexity: 235  
Covalently-Bonded Unit Count: 1  
Defined Atom Stereocenter Count: 4  
Heavy Atom Count: 15  
Hydrogen Bond Acceptor Count: 6  
Hydrogen Bond Donor Count: 5  
Rotatable Bond Count: 2  
Undefined Atom Stereocenter Count: 1  
XLogP3: -1.7  

 

 

Upstream Synthesis Route
  • 2-Acetamido-2-Deoxy-D-Galactopyranose, also known as $name$, plays a crucial role in chemical synthesis as a key intermediate in the production of various pharmaceuticals, especially in the synthesis of antiviral drugs and antibiotics. Its unique structure allows for versatile functional group modifications, making it a valuable building block for creating complex drug molecules with specific biological activities. In addition, $name$ is commonly used as a core component in the synthesis of glycosidic linkages, which are essential for the development of carbohydrate-based drugs and bioconjugates. Its importance in chemical synthesis extends to diverse applications in medicinal chemistry and drug discovery, highlighting its significance in the pharmaceutical industry.
FEATURED PRODUCTS