AB57956
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $6.00 | $4.00 | - + | |
250mg | 95% | in stock | $7.00 | $5.00 | - + | |
1g | 95% | in stock | $9.00 | $6.00 | - + | |
5g | 95% | in stock | $28.00 | $19.00 | - + | |
10g | 95% | in stock | $53.00 | $37.00 | - + | |
25g | 95% | in stock | $95.00 | $67.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB57956 |
Chemical Name: | 1-Boc-3-bromoindole |
CAS Number: | 143259-56-7 |
Molecular Formula: | C13H14BrNO2 |
Molecular Weight: | 296.1598 |
MDL Number: | MFCD05864772 |
SMILES: | Brc1cn(c2c1cccc2)C(=O)OC(C)(C)C |
Complexity: | 300 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 4 |
The Journal of organic chemistry 20090306