AA72622
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $12.00 | $9.00 | - + | |
1g | 95% | in stock | $26.00 | $18.00 | - + | |
5g | 95% | in stock | $46.00 | $33.00 | - + | |
25g | 95% | in stock | $130.00 | $91.00 | - + | |
250g | 95% | in stock | $1,263.00 | $884.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA72622 |
Chemical Name: | Cholan-24-oic acid, 3,7,12-trihydroxy-, methyl ester, (3α,5β,7α,12α)- |
CAS Number: | 1448-36-8 |
Molecular Formula: | C25H42O5 |
Molecular Weight: | 422.598 |
MDL Number: | MFCD00064934 |
SMILES: | COC(=O)CC[C@H]([C@H]1CC[C@@H]2[C@]1(C)[C@@H](O)C[C@H]1[C@H]2[C@H](O)C[C@H]2[C@]1(C)CC[C@H](C2)O)C |
Complexity: | 652 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 11 |
Heavy Atom Count: | 30 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 5 |
XLogP3: | 3.9 |
International journal of pharmaceutics 20110915
Steroids 20090101
Journal of pharmacological sciences 20080701
The Journal of biological chemistry 20061013
Steroids 20050701
Archives of pharmacal research 20040601
Journal of medicinal chemistry 20020801