1448314-31-5 | Neutrophil Elastase Inhibitor

Packsize	Purity	Availability	Price	Discounted Price
10mg	95%	in stock	$148.00	$104.00
25mg	95%	in stock	$348.00	$243.00
50mg	95%	in stock	$614.00	$430.00

Description

• Catalog Number: AF04482
• Chemical Name: Neutrophil Elastase Inhibitor
• CAS Number: 1448314-31-5
• Molecular Formula: C16H11N3O
• Molecular Weight: 261.27804
• MDL Number: MFCD28023604
• SMILES: N#Cc1nn(c2c1cccc2)C(=O)c1cccc(c1)C

Upstream Synthesis Route

The synthesis of a Neutrophil Elastase Inhibitor typically involves multiple organic synthesis steps, which are tailored according to the specific inhibitor structure in question. Here is a generalized synthesis pathway for a peptidomimetic Neutrophil Elastase Inhibitor:

1. **Amino acid derivation**: Start with the protection of the amino group on amino acids using a protection group such as Boc (tert-butyloxycarbonyl).

2. **Peptide bond formation**: Employ standard peptide coupling reactions such as using DCC (N,N'-dicyclohexylcarbodiimide) or EDC (1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide) in the presence of HOBt (1-Hydroxybenzotriazole) for the condensation of the protected amino acids. Peptide bonds are formed between the amino acids to build up the inhibitor peptide backbone.

3. **Introduction of side chain functionalities**: Introduce side chain protecting groups specific to the chemistry of the side chains of the amino acids involved. For example, use Fmoc (9-fluorenylmethyloxycarbonyl) for the protection of the hydroxyl group on serine or threonine amino acids.

4. **Capping of terminal groups**: Cap the terminal amino group with an acetyl group if needed to prevent further elongation.

5. **Cleavage of protecting groups**: Once the peptide backbone is complete, remove the protecting groups using appropriate deprotection conditions. For example, TFA (Trifluoroacetic acid) can be used to remove Boc protection.

6. **Coupling with aldehyde or ketone**: To introduce the aldehyde functionality, couple an aldehyde or a protected derivative thereof to the N-terminal of the peptide using reductive amination.

7. **Cyclization**: If the structure calls for it, cyclize the peptide using appropriate conditions. For example, head-to-tail cyclization can be achieved through activating reagents like PyBOP.

8. **Purification**: Employ HPLC (High-Performance Liquid Chromatography) for the purification of the synthesized inhibitor.

9. **Characterization**: Confirm the structure and purity of the inhibitor by analytical methods such as NMR (Nuclear Magnetic Resonance), MS (Mass Spectrometry), and IR (Infrared Spectroscopy).

This represents a generalized route for peptidomimetic inhibitors. Please note that the specific synthesis route would be largely dependent on the exact chemical structure of the Neutrophil Elastase Inhibitor being synthesized.