AA73402
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $6.00 | $4.00 | - + | |
5g | 98% | in stock | $7.00 | $5.00 | - + | |
10g | 98% | in stock | $12.00 | $9.00 | - + | |
25g | 98% | in stock | $28.00 | $19.00 | - + | |
100g | 98% | in stock | $87.00 | $61.00 | - + | |
500g | 98% | in stock | $377.00 | $264.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA73402 |
Chemical Name: | 3,5-Dimethyl-4-nitro-1H-pyrazole |
CAS Number: | 14531-55-6 |
Molecular Formula: | C5H7N3O2 |
Molecular Weight: | 141.1280 |
MDL Number: | MFCD00052513 |
SMILES: | [O-][N+](=O)c1c(C)n[nH]c1C |
Complexity: | 144 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 0.8 |
Beilstein journal of organic chemistry 20110101