AA63337
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $106.00 | $75.00 | - + | |
5g | 95% | in stock | $299.00 | $209.00 | - + | |
25g | 95% | in stock | $1,148.00 | $804.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA63337 |
Chemical Name: | 1,1,3,3-Tetramethylbutyl isocyanide |
CAS Number: | 14542-93-9 |
Molecular Formula: | C9H17N |
Molecular Weight: | 139.2380 |
MDL Number: | MFCD00000003 |
SMILES: | CC(CC(C)(C)C)([N+]#[C-])C |
NSC Number: | 141688 |
Complexity: | 151 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.6 |
Journal of bioscience and bioengineering 20080801
Inorganic chemistry 20070305