logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Piperidines  > tert-Butyl 4-(iodomethyl)piperidine-1-carboxylate

AA63485

145508-94-7 | tert-Butyl 4-(iodomethyl)piperidine-1-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $15.00 $10.00 -   +
5g 95% in stock $17.00 $12.00 -   +
10g 95% in stock $31.00 $22.00 -   +
25g 95% in stock $74.00 $52.00 -   +
100g 95% in stock $257.00 $180.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA63485
Chemical Name: tert-Butyl 4-(iodomethyl)piperidine-1-carboxylate
CAS Number: 145508-94-7
Molecular Formula: C11H20INO2
Molecular Weight: 325.1864700000001
MDL Number: MFCD08437653
SMILES: ICC1CCN(CC1)C(=O)OC(C)(C)C

 

Upstream Synthesis Route 
  • 1-Piperidinecarboxylic acid, 4-(iodomethyl)-, 1,1-dimethylethyl ester plays a crucial role in chemical synthesis as a versatile building block. Its unique chemical structure enables it to participate in various reactions, allowing for the creation of complex organic compounds. This compound is often utilized in the synthesis of pharmaceuticals, agrochemicals, and materials due to its ability to introduce the piperidine moiety into target molecules. Additionally, its iodomethyl group can serve as a reactive site for further derivatization, expanding its synthetic utility. In organic synthesis, this compound acts as a valuable tool for the development of new molecules with tailored properties and functionalities. Its compatibility with a wide range of reaction conditions and its ability to undergo diverse transformations make it a valuable asset in chemical research and development.
FEATURED PRODUCTS