AX46924
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $48.00 | $34.00 | - + | |
5mg | 98% | in stock | $142.00 | $99.00 | - + | |
10mg | 98% | in stock | $185.00 | $129.00 | - + | |
25mg | 98% | in stock | $240.00 | $168.00 | - + | |
50mg | 98% | in stock | $313.00 | $219.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX46924 |
Chemical Name: | GJ103 sodium salt |
CAS Number: | 1459687-96-7 |
Molecular Formula: | C16H13N4NaO3S |
Molecular Weight: | 364.3542 |
MDL Number: | MFCD30738009 |
SMILES: | COc1cccc(c1)n1c(SCC(=O)[O-])nnc1c1ccccn1.[Na+] |
Complexity: | 434 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 7 |
Rotatable Bond Count: | 6 |
The Journal of biological chemistry 19760125