AA64929
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | in stock | $89.00 | $63.00 | - + | ||
5g | in stock | $97.00 | $68.00 | - + | ||
25g | in stock | $235.00 | $165.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA64929 |
Chemical Name: | 3,5-Dimethyladamantane-1-carboxylic acid |
CAS Number: | 14670-94-1 |
Molecular Formula: | C13H20O2 |
Molecular Weight: | 208.2967 |
MDL Number: | MFCD00188067 |
SMILES: | OC(=O)C12CC3CC(C2)(CC(C1)(C3)C)C |
Complexity: | 315 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
Undefined Atom Stereocenter Count: | 2 |
XLogP3: | 3.2 |
Journal of medicinal chemistry 20100211